C24H22ClN3O4 — CID 50882389
N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 50882389) has the molecular formula C24H22ClN3O4 and a molecular weight of 451.91 g/mol. Its IUPAC name is N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 50882389 |
| Molecular Formula | C24H22ClN3O4 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | N-[4-chloro-2-[hydroxy(phenyl)methyl]phenyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(O)c1ccccc1)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H22ClN3O4/c25-18-9-10-20(19(15-18)23(29)16-6-2-1-3-7-16)26-24(30)17-8-11-21(22(14-17)28(31)32)27-12-4-5-13-27/h1-3,6-11,14-15,23,29H,4-5,12-13H2,(H,26,30) |
| InChIKey | GZXKXHHTFBQBHN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|