C19H21N5O4S — CID 6303807
3-nitro-4-[(2Z)-2-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]benzenesulfonamide (PubChem CID 6303807) has the molecular formula C19H21N5O4S and a molecular weight of 415.48 g/mol. Its IUPAC name is 3-nitro-4-[(2Z)-2-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]benzenesulfonamide.
| Compound Name | 3-nitro-4-[(2Z)-2-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6303807 |
| Molecular Formula | C19H21N5O4S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-nitro-4-[(2Z)-2-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]hydrazinyl]benzenesulfonamide |
| SMILES | CN1/C(=C\C=N/Nc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H21N5O4S/c1-19(2)14-6-4-5-7-16(14)23(3)18(19)10-11-21-22-15-9-8-13(29(20,27)28)12-17(15)24(25)26/h4-12,22H,1-3H3,(H2,20,27,28)/b18-10-,21-11- |
| InChIKey | CJFVETUYPNRBGJ-OFEFNGSWSA-N |
| XLogP | 2.95 |
| TPSA | 130.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|