C13H12N4O6S — CID 4077408
4-[2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 4077408) has the molecular formula C13H12N4O6S and a molecular weight of 352.33 g/mol. Its IUPAC name is 4-[2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4077408 |
| Molecular Formula | C13H12N4O6S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 4-[2-[(3,4-dihydroxyphenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NN=Cc2ccc(O)c(O)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N4O6S/c14-24(22,23)9-2-3-10(11(6-9)17(20)21)16-15-7-8-1-4-12(18)13(19)5-8/h1-7,16,18-19H,(H2,14,22,23) |
| InChIKey | OQNDRBZLEBWNRQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|