C27H24N4O6S — CID 4638398
4-[2-[[3,4-bis(phenylmethoxy)phenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 4638398) has the molecular formula C27H24N4O6S and a molecular weight of 532.58 g/mol. Its IUPAC name is 4-[2-[[3,4-bis(phenylmethoxy)phenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[[3,4-bis(phenylmethoxy)phenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4638398 |
| Molecular Formula | C27H24N4O6S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 4-[2-[[3,4-bis(phenylmethoxy)phenyl]methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NN=Cc2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H24N4O6S/c28-38(34,35)23-12-13-24(25(16-23)31(32)33)30-29-17-22-11-14-26(36-18-20-7-3-1-4-8-20)27(15-22)37-19-21-9-5-2-6-10-21/h1-17,30H,18-19H2,(H2,28,34,35) |
| InChIKey | SHDZMAULALTQPE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|