C14H16N2O2 — CID 124578333
(4aR)-4a,9-dimethyl-6-nitro-3,4-dihydro-2H-carbazole (PubChem CID 124578333) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is (4aR)-4a,9-dimethyl-6-nitro-3,4-dihydro-2H-carbazole.
| Compound Name | (4aR)-4a,9-dimethyl-6-nitro-3,4-dihydro-2H-carbazole |
|---|---|
| PubChem CID | 124578333 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (4aR)-4a,9-dimethyl-6-nitro-3,4-dihydro-2H-carbazole |
| SMILES | CN1C2=CCCC[C@]2(C)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H16N2O2/c1-14-8-4-3-5-13(14)15(2)12-7-6-10(16(17)18)9-11(12)14/h5-7,9H,3-4,8H2,1-2H3/t14-/m1/s1 |
| InChIKey | HHURANSYYXGWMM-CQSZACIVSA-N |
| XLogP | 3.37 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|