C14H12N3O4P — CID 71370251
5,10-dimethyl-2,8-dinitrophenophosphazinine (PubChem CID 71370251) has the molecular formula C14H12N3O4P and a molecular weight of 317.24 g/mol. Its IUPAC name is 5,10-dimethyl-2,8-dinitrophenophosphazinine.
| Compound Name | 5,10-dimethyl-2,8-dinitrophenophosphazinine |
|---|---|
| PubChem CID | 71370251 |
| Molecular Formula | C14H12N3O4P |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 5,10-dimethyl-2,8-dinitrophenophosphazinine |
| SMILES | CN1c2ccc([N+](=O)[O-])cc2P(C)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H12N3O4P/c1-15-11-5-3-9(16(18)19)7-13(11)22(2)14-8-10(17(20)21)4-6-12(14)15/h3-8H,1-2H3 |
| InChIKey | CEZPEBGIGHIREF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|