C17H15F3N2O2 — CID 10497071
(2S,3R)-1,3-dimethyl-5-nitro-2-phenyl-3-(trifluoromethyl)-2H-indole (PubChem CID 10497071) has the molecular formula C17H15F3N2O2 and a molecular weight of 336.31 g/mol. Its IUPAC name is (2S,3R)-1,3-dimethyl-5-nitro-2-phenyl-3-(trifluoromethyl)-2H-indole.
| Compound Name | (2S,3R)-1,3-dimethyl-5-nitro-2-phenyl-3-(trifluoromethyl)-2H-indole |
|---|---|
| PubChem CID | 10497071 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2S,3R)-1,3-dimethyl-5-nitro-2-phenyl-3-(trifluoromethyl)-2H-indole |
| SMILES | CN1c2ccc([N+](=O)[O-])cc2[C@@](C)(C(F)(F)F)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15F3N2O2/c1-16(17(18,19)20)13-10-12(22(23)24)8-9-14(13)21(2)15(16)11-6-4-3-5-7-11/h3-10,15H,1-2H3/t15-,16+/m0/s1 |
| InChIKey | MKRGXNDNVGBYER-JKSUJKDBSA-N |
| XLogP | 4.61 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|