C31H30N3O2P — CID 75409301
(2-methyl-5-nitrophenyl)imino-diphenyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphane (PubChem CID 75409301) has the molecular formula C31H30N3O2P and a molecular weight of 507.57 g/mol. Its IUPAC name is (2-methyl-5-nitrophenyl)imino-diphenyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphane.
| Compound Name | (2-methyl-5-nitrophenyl)imino-diphenyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphane |
|---|---|
| PubChem CID | 75409301 |
| Molecular Formula | C31H30N3O2P |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | (2-methyl-5-nitrophenyl)imino-diphenyl-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]-λ5-phosphane |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N=P(/C=C1/N(C)c2ccccc2C1(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30N3O2P/c1-23-19-20-24(34(35)36)21-28(23)32-37(25-13-7-5-8-14-25,26-15-9-6-10-16-26)22-30-31(2,3)27-17-11-12-18-29(27)33(30)4/h5-22H,1-4H3/b30-22+ |
| InChIKey | ZYADIEXFSJKNTJ-JBASAIQMSA-N |
| XLogP | 7.66 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|