C24H23N2O4P — CID 71902193
1,3,3-trimethyl-2-[[(2-nitrophenoxy)-phenylphosphoryl]methylidene]indole (PubChem CID 71902193) has the molecular formula C24H23N2O4P and a molecular weight of 434.43 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[[(2-nitrophenoxy)-phenylphosphoryl]methylidene]indole.
| Compound Name | 1,3,3-trimethyl-2-[[(2-nitrophenoxy)-phenylphosphoryl]methylidene]indole |
|---|---|
| PubChem CID | 71902193 |
| Molecular Formula | C24H23N2O4P |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1,3,3-trimethyl-2-[[(2-nitrophenoxy)-phenylphosphoryl]methylidene]indole |
| SMILES | CN1C(=CP(=O)(Oc2ccccc2[N+](=O)[O-])c2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H23N2O4P/c1-24(2)19-13-7-8-14-20(19)25(3)23(24)17-31(29,18-11-5-4-6-12-18)30-22-16-10-9-15-21(22)26(27)28/h4-17H,1-3H3 |
| InChIKey | GUWVWDUIPAYFNV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|