C36H40N4Sn — CID 58250004
1,4,6,9-tetrakis(2,6-dimethylphenyl)-1,4,6,9-tetraza-5-stannaspiro[4.4]nona-2,7-diene (PubChem CID 58250004) has the molecular formula C36H40N4Sn and a molecular weight of 647.46 g/mol. Its IUPAC name is 1,4,6,9-tetrakis(2,6-dimethylphenyl)-1,4,6,9-tetraza-5-stannaspiro[4.4]nona-2,7-diene.
| Compound Name | 1,4,6,9-tetrakis(2,6-dimethylphenyl)-1,4,6,9-tetraza-5-stannaspiro[4.4]nona-2,7-diene |
|---|---|
| PubChem CID | 58250004 |
| Molecular Formula | C36H40N4Sn |
| Molecular Weight | 647.46 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | 1,4,6,9-tetrakis(2,6-dimethylphenyl)-1,4,6,9-tetraza-5-stannaspiro[4.4]nona-2,7-diene |
| SMILES | Cc1cccc(C)c1N1C=CN(c2c(C)cccc2C)[Sn]12N(c1c(C)cccc1C)C=CN2c1c(C)cccc1C |
| InChI | InChI=1S/2C18H20N2.Sn/c2*1-13-7-5-8-14(2)17(13)19-11-12-20-18-15(3)9-6-10-16(18)4;/h2*5-12H,1-4H3;/q2*-2;+4/b2*12-11-; |
| InChIKey | ADWIBYHMPYDRMD-ZELJJWTBSA-N |
| XLogP | 8.89 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.46 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |