C15H23NO — CID 145026815
3-(2,6-dimethylphenyl)-2,2-dimethyl-1,3-oxazole;ethane (PubChem CID 145026815) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-2,2-dimethyl-1,3-oxazole;ethane.
| Compound Name | 3-(2,6-dimethylphenyl)-2,2-dimethyl-1,3-oxazole;ethane |
|---|---|
| PubChem CID | 145026815 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-2,2-dimethyl-1,3-oxazole;ethane |
| SMILES | CC.Cc1cccc(C)c1N1C=COC1(C)C |
| InChI | InChI=1S/C13H17NO.C2H6/c1-10-6-5-7-11(2)12(10)14-8-9-15-13(14,3)4;1-2/h5-9H,1-4H3;1-2H3 |
| InChIKey | UZDQWYJJOOBBKJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |