C20H26N2S — CID 143992406
2,5-bis(2,6-dimethylphenyl)-1,1-dimethyl-1,2,5-thiadiazole (PubChem CID 143992406) has the molecular formula C20H26N2S and a molecular weight of 326.51 g/mol. Its IUPAC name is 2,5-bis(2,6-dimethylphenyl)-1,1-dimethyl-1,2,5-thiadiazole.
| Compound Name | 2,5-bis(2,6-dimethylphenyl)-1,1-dimethyl-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 143992406 |
| Molecular Formula | C20H26N2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2,5-bis(2,6-dimethylphenyl)-1,1-dimethyl-1,2,5-thiadiazole |
| SMILES | Cc1cccc(C)c1N1C=CN(c2c(C)cccc2C)S1(C)C |
| InChI | InChI=1S/C20H26N2S/c1-15-9-7-10-16(2)19(15)21-13-14-22(23(21,5)6)20-17(3)11-8-12-18(20)4/h7-14H,1-6H3 |
| InChIKey | RVYFJUPCUMYDOF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |