C18H21ClN2Sn — CID 147973830
2-chloro-1,3-bis(2,6-dimethylphenyl)-2H-1,3,2-diazastannole (PubChem CID 147973830) has the molecular formula C18H21ClN2Sn and a molecular weight of 419.54 g/mol. Its IUPAC name is 2-chloro-1,3-bis(2,6-dimethylphenyl)-2H-1,3,2-diazastannole.
| Compound Name | 2-chloro-1,3-bis(2,6-dimethylphenyl)-2H-1,3,2-diazastannole |
|---|---|
| PubChem CID | 147973830 |
| Molecular Formula | C18H21ClN2Sn |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 2-chloro-1,3-bis(2,6-dimethylphenyl)-2H-1,3,2-diazastannole |
| SMILES | Cc1cccc(C)c1N1C=CN(c2c(C)cccc2C)[SnH]1Cl |
| InChI | InChI=1S/C18H20N2.ClH.Sn.H/c1-13-7-5-8-14(2)17(13)19-11-12-20-18-15(3)9-6-10-16(18)4;;;/h5-12H,1-4H3;1H;;/q-2;;+3;/p-1/b12-11-;;; |
| InChIKey | IRWOQDUIMXIWOM-XSMOKHOMSA-M |
| XLogP | 4.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |