C28H35N2P — CID 102083910
1,3-bis(2,6-dimethylphenyl)-2-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-1,3,2-diazaphosphole (PubChem CID 102083910) has the molecular formula C28H35N2P and a molecular weight of 430.58 g/mol. Its IUPAC name is 1,3-bis(2,6-dimethylphenyl)-2-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-1,3,2-diazaphosphole.
| Compound Name | 1,3-bis(2,6-dimethylphenyl)-2-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-1,3,2-diazaphosphole |
|---|---|
| PubChem CID | 102083910 |
| Molecular Formula | C28H35N2P |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 1,3-bis(2,6-dimethylphenyl)-2-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)-1,3,2-diazaphosphole |
| SMILES | CC1=C(C)C(C)(P2N(c3c(C)cccc3C)C=CN2c2c(C)cccc2C)C(C)=C1C |
| InChI | InChI=1S/C28H35N2P/c1-18-12-10-13-19(2)26(18)29-16-17-30(27-20(3)14-11-15-21(27)4)31(29)28(9)24(7)22(5)23(6)25(28)8/h10-17H,1-9H3 |
| InChIKey | UWJKCUWPYJQRMQ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|