C44H56BN4P — CID 139163001
2-[1,3-bis[2,6-di(propan-2-yl)phenyl]-1,3,2-diazaborol-2-yl]-1,3-bis(2,6-dimethylphenyl)-1,3,2-diazaphosphole (PubChem CID 139163001) has the molecular formula C44H56BN4P and a molecular weight of 682.75 g/mol. Its IUPAC name is 2-[1,3-bis[2,6-di(propan-2-yl)phenyl]-1,3,2-diazaborol-2-yl]-1,3-bis(2,6-dimethylphenyl)-1,3,2-diazaphosphole.
| Compound Name | 2-[1,3-bis[2,6-di(propan-2-yl)phenyl]-1,3,2-diazaborol-2-yl]-1,3-bis(2,6-dimethylphenyl)-1,3,2-diazaphosphole |
|---|---|
| PubChem CID | 139163001 |
| Molecular Formula | C44H56BN4P |
| Molecular Weight | 682.75 g/mol |
| Exact Mass | 682.43 |
| IUPAC Name | 2-[1,3-bis[2,6-di(propan-2-yl)phenyl]-1,3,2-diazaborol-2-yl]-1,3-bis(2,6-dimethylphenyl)-1,3,2-diazaphosphole |
| SMILES | Cc1cccc(C)c1N1C=CN(c2c(C)cccc2C)P1B1N(c2c(C(C)C)cccc2C(C)C)C=CN1c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C44H56BN4P/c1-29(2)37-21-15-22-38(30(3)4)43(37)46-25-26-47(44-39(31(5)6)23-16-24-40(44)32(7)8)45(46)50-48(41-33(9)17-13-18-34(41)10)27-28-49(50)42-35(11)19-14-20-36(42)12/h13-32H,1-12H3 |
| InChIKey | AFPCFURUHBFBQB-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.75 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|