C22H24BN3 — CID 177454514
1,3-bis(2,6-dimethylphenyl)-1,3,2-benzodiazaborol-2-amine (PubChem CID 177454514) has the molecular formula C22H24BN3 and a molecular weight of 341.27 g/mol. Its IUPAC name is 1,3-bis(2,6-dimethylphenyl)-1,3,2-benzodiazaborol-2-amine.
| Compound Name | 1,3-bis(2,6-dimethylphenyl)-1,3,2-benzodiazaborol-2-amine |
|---|---|
| PubChem CID | 177454514 |
| Molecular Formula | C22H24BN3 |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1,3-bis(2,6-dimethylphenyl)-1,3,2-benzodiazaborol-2-amine |
| SMILES | Cc1cccc(C)c1N1B(N)N(c2c(C)cccc2C)c2ccccc21 |
| InChI | InChI=1S/C22H24BN3/c1-15-9-7-10-16(2)21(15)25-19-13-5-6-14-20(19)26(23(25)24)22-17(3)11-8-12-18(22)4/h5-14H,24H2,1-4H3 |
| InChIKey | VXBZPKUJJFBPEB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|