C14H14N2O — CID 141446467
9,10-dimethyl-5H-phenazin-1-ol (PubChem CID 141446467) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 9,10-dimethyl-5H-phenazin-1-ol.
| Compound Name | 9,10-dimethyl-5H-phenazin-1-ol |
|---|---|
| PubChem CID | 141446467 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 9,10-dimethyl-5H-phenazin-1-ol |
| SMILES | Cc1cccc2c1N(C)c1c(O)cccc1N2 |
| InChI | InChI=1S/C14H14N2O/c1-9-5-3-6-10-13(9)16(2)14-11(15-10)7-4-8-12(14)17/h3-8,15,17H,1-2H3 |
| InChIKey | FMZYVIZVRQJQCH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |