About 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine
1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine (PubChem CID 59165034) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine.
Molecular Properties
| Compound Name | 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine |
| PubChem CID | 59165034 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine |
| SMILES | CC1=NN(C)c2ccccc2CC1 |
| InChI | InChI=1S/C11H14N2/c1-9-7-8-10-5-3-4-6-11(10)13(2)12-9/h3-6H,7-8H2,1-2H3 |
| InChIKey | DRQWKXSNEOCCRN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine?
The IUPAC name of 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine (CID 59165034) is 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine.
What is the SMILES notation for 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine?
The canonical SMILES for 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine is CC1=NN(C)c2ccccc2CC1.
What is the InChIKey of 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine?
The InChIKey is DRQWKXSNEOCCRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-9-7-8-10-5-3-4-6-11(10)13(2)12-9/h3-6H,7-8H2,1-2H3.
What are the key properties of 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine?
1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine has a molecular weight of 174.25 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-4,5-dihydro-1,2-benzodiazepine is sourced from PubChem (CID 59165034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).