C17H18BN — CID 119078430
CID 119078430 (PubChem CID 119078430) has the molecular formula C17H18BN and a molecular weight of 247.15 g/mol.
| Compound Name | CID 119078430 |
|---|---|
| PubChem CID | 119078430 |
| Molecular Formula | C17H18BN |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | — |
| SMILES | [B]CCCN1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C17H18BN/c18-12-5-13-19-16-8-3-1-6-14(16)10-11-15-7-2-4-9-17(15)19/h1-4,6-9H,5,10-13H2 |
| InChIKey | ISUKNPQDYZOZDU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|