About O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride
O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride (PubChem CID 90481812) has the molecular formula C16H19ClN2O
and a molecular weight of 290.79 g/mol. Its IUPAC name is O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride.
Molecular Properties
| Compound Name | O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride |
| PubChem CID | 90481812 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride |
| SMILES | Cl.NOCCN1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C16H18N2O.ClH/c17-19-12-11-18-15-7-3-1-5-13(15)9-10-14-6-2-4-8-16(14)18;/h1-8H,9-12,17H2;1H |
| InChIKey | LZGCTLGTKCAING-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride?
The IUPAC name of O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride (CID 90481812) is O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride.
What is the SMILES notation for O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride?
The canonical SMILES for O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride is Cl.NOCCN1c2ccccc2CCc2ccccc21.
What is the InChIKey of O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride?
The InChIKey is LZGCTLGTKCAING-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O.ClH/c17-19-12-11-18-15-7-3-1-5-13(15)9-10-14-6-2-4-8-16(14)18;/h1-8H,9-12,17H2;1H.
What are the key properties of O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride?
O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride has a molecular weight of 290.79 g/mol, XLogP of 3.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)ethyl]hydroxylamine;hydrochloride is sourced from PubChem (CID 90481812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).