C19H24N2 — CID 91474056
3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-ethylpropan-1-amine (PubChem CID 91474056) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-ethylpropan-1-amine.
| Compound Name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 91474056 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-ethylpropan-1-amine |
| SMILES | CCNCCCN1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C19H24N2/c1-2-20-14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21/h3-6,8-11,20H,2,7,12-15H2,1H3 |
| InChIKey | GMKRSNWYXVXKFF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|