C20H29BN3+ — CID 166589253
5,8,16,16-tetramethyl-5,13-diaza-2-azonia-1-boratetracyclo[11.7.0.02,6.07,12]icosa-2(6),3,7,9,11-pentaene (PubChem CID 166589253) has the molecular formula C20H29BN3+ and a molecular weight of 322.29 g/mol. Its IUPAC name is 5,8,16,16-tetramethyl-5,13-diaza-2-azonia-1-boratetracyclo[11.7.0.02,6.07,12]icosa-2(6),3,7,9,11-pentaene.
| Compound Name | 5,8,16,16-tetramethyl-5,13-diaza-2-azonia-1-boratetracyclo[11.7.0.02,6.07,12]icosa-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 166589253 |
| Molecular Formula | C20H29BN3+ |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 5,8,16,16-tetramethyl-5,13-diaza-2-azonia-1-boratetracyclo[11.7.0.02,6.07,12]icosa-2(6),3,7,9,11-pentaene |
| SMILES | Cc1cccc2c1-c1n(C)cc[n+]1B1CCCCC(C)(C)CCN12 |
| InChI | InChI=1S/C20H29BN3/c1-16-8-7-9-17-18(16)19-22(4)14-15-24(19)21-12-6-5-10-20(2,3)11-13-23(17)21/h7-9,14-15H,5-6,10-13H2,1-4H3/q+1 |
| InChIKey | XXOPHCBDYBPFMZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|