C20H28BN4+ — CID 157090551
6-methyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)-1,6-diaza-4-azonia-5-boratetracyclo[9.2.1.04,13.07,12]tetradeca-2,4(13),7,9,11-pentaene (PubChem CID 157090551) has the molecular formula C20H28BN4+ and a molecular weight of 335.28 g/mol. Its IUPAC name is 6-methyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)-1,6-diaza-4-azonia-5-boratetracyclo[9.2.1.04,13.07,12]tetradeca-2,4(13),7,9,11-pentaene.
| Compound Name | 6-methyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)-1,6-diaza-4-azonia-5-boratetracyclo[9.2.1.04,13.07,12]tetradeca-2,4(13),7,9,11-pentaene |
|---|---|
| PubChem CID | 157090551 |
| Molecular Formula | C20H28BN4+ |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 6-methyl-5-(2,2,6,6-tetramethylpiperidin-1-yl)-1,6-diaza-4-azonia-5-boratetracyclo[9.2.1.04,13.07,12]tetradeca-2,4(13),7,9,11-pentaene |
| SMILES | CN1B(N2C(C)(C)CCCC2(C)C)[n+]2ccn3c2-c2c(cccc21)C3 |
| InChI | InChI=1S/C20H28BN4/c1-19(2)10-7-11-20(3,4)25(19)21-22(5)16-9-6-8-15-14-23-12-13-24(21)18(23)17(15)16/h6,8-9,12-13H,7,10-11,14H2,1-5H3/q+1 |
| InChIKey | LSUSSCJDSKAFFZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|