C30H44BClN2 — CID 132966148
chloro-bis[2-(2,2,6,6-tetramethylpiperidin-1-yl)phenyl]borane (PubChem CID 132966148) has the molecular formula C30H44BClN2 and a molecular weight of 478.96 g/mol. Its IUPAC name is chloro-bis[2-(2,2,6,6-tetramethylpiperidin-1-yl)phenyl]borane.
| Compound Name | chloro-bis[2-(2,2,6,6-tetramethylpiperidin-1-yl)phenyl]borane |
|---|---|
| PubChem CID | 132966148 |
| Molecular Formula | C30H44BClN2 |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | chloro-bis[2-(2,2,6,6-tetramethylpiperidin-1-yl)phenyl]borane |
| SMILES | CC1(C)CCCC(C)(C)N1c1ccccc1B(Cl)c1ccccc1N1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C30H44BClN2/c1-27(2)19-13-20-28(3,4)33(27)25-17-11-9-15-23(25)31(32)24-16-10-12-18-26(24)34-29(5,6)21-14-22-30(34,7)8/h9-12,15-18H,13-14,19-22H2,1-8H3 |
| InChIKey | GUXPWNJJIOIDGT-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|