C15H23NO2 — CID 161461373
1-(2-hydroxyphenyl)-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 161461373) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-(2-hydroxyphenyl)-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 161461373 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-(2-hydroxyphenyl)-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1c1ccccc1O |
| InChI | InChI=1S/C15H23NO2/c1-14(2)9-11(17)10-15(3,4)16(14)12-7-5-6-8-13(12)18/h5-8,11,17-18H,9-10H2,1-4H3 |
| InChIKey | JQAFOQVDMJLMJS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |