C16H19NO — CID 89064920
13,15-dimethyl-11-azatricyclo[8.5.0.011,13]pentadeca-1(10),2,4,6,8-pentaen-2-ol (PubChem CID 89064920) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 13,15-dimethyl-11-azatricyclo[8.5.0.011,13]pentadeca-1(10),2,4,6,8-pentaen-2-ol.
| Compound Name | 13,15-dimethyl-11-azatricyclo[8.5.0.011,13]pentadeca-1(10),2,4,6,8-pentaen-2-ol |
|---|---|
| PubChem CID | 89064920 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 13,15-dimethyl-11-azatricyclo[8.5.0.011,13]pentadeca-1(10),2,4,6,8-pentaen-2-ol |
| SMILES | CC1CC2(C)CN2c2cccccccc(O)c21 |
| InChI | InChI=1S/C16H19NO/c1-12-10-16(2)11-17(16)13-8-6-4-3-5-7-9-14(18)15(12)13/h3-9,12,18H,10-11H2,1-2H3/b4-3-,5-3-,6-4+,7-5-,8-6+,9-7+,13-8+,14-9-,15-14+ |
| InChIKey | BVSAFKVWFVVVTQ-FDMQHSTASA-N |
| XLogP | 3.60 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|