C18H29NO — CID 141174463
2,2,6,6-tetramethyl-1-(1-phenylpropyl)piperidin-4-ol (PubChem CID 141174463) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(1-phenylpropyl)piperidin-4-ol.
| Compound Name | 2,2,6,6-tetramethyl-1-(1-phenylpropyl)piperidin-4-ol |
|---|---|
| PubChem CID | 141174463 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(1-phenylpropyl)piperidin-4-ol |
| SMILES | CCC(c1ccccc1)N1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C18H29NO/c1-6-16(14-10-8-7-9-11-14)19-17(2,3)12-15(20)13-18(19,4)5/h7-11,15-16,20H,6,12-13H2,1-5H3 |
| InChIKey | KBTRXYAQPGCGPD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |