C15H23NO4 — CID 90787196
2-(hydroxymethyl)-1-(1-phenylpropyl)piperidine-3,4,5-triol (PubChem CID 90787196) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-(1-phenylpropyl)piperidine-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-1-(1-phenylpropyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 90787196 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-(hydroxymethyl)-1-(1-phenylpropyl)piperidine-3,4,5-triol |
| SMILES | CCC(c1ccccc1)N1CC(O)C(O)C(O)C1CO |
| InChI | InChI=1S/C15H23NO4/c1-2-11(10-6-4-3-5-7-10)16-8-13(18)15(20)14(19)12(16)9-17/h3-7,11-15,17-20H,2,8-9H2,1H3 |
| InChIKey | HFUBMFGRAQZFDE-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |