C24H42N4O3 — CID 151982293
1-(2-amino-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxyanilino)oxy-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 151982293) has the molecular formula C24H42N4O3 and a molecular weight of 434.63 g/mol. Its IUPAC name is 1-(2-amino-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxyanilino)oxy-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-(2-amino-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxyanilino)oxy-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 151982293 |
| Molecular Formula | C24H42N4O3 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.33 |
| IUPAC Name | 1-(2-amino-N-(2,2,6,6-tetramethylpiperidin-1-yl)oxyanilino)oxy-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CCCC(C)(C)N1ON(ON1C(C)(C)CC(O)CC1(C)C)c1ccccc1N |
| InChI | InChI=1S/C24H42N4O3/c1-21(2)14-11-15-22(3,4)27(21)30-26(20-13-10-9-12-19(20)25)31-28-23(5,6)16-18(29)17-24(28,7)8/h9-10,12-13,18,29H,11,14-17,25H2,1-8H3 |
| InChIKey | UCXYZQULUZBDOQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|