C12H25N3OS — CID 154084290
1,3-dimethyl-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxythiourea (PubChem CID 154084290) has the molecular formula C12H25N3OS and a molecular weight of 259.42 g/mol. Its IUPAC name is 1,3-dimethyl-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxythiourea.
| Compound Name | 1,3-dimethyl-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxythiourea |
|---|---|
| PubChem CID | 154084290 |
| Molecular Formula | C12H25N3OS |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1,3-dimethyl-1-(2,2,6,6-tetramethylpiperidin-1-yl)oxythiourea |
| SMILES | CNC(=S)N(C)ON1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C12H25N3OS/c1-11(2)8-7-9-12(3,4)15(11)16-14(6)10(17)13-5/h7-9H2,1-6H3,(H,13,17) |
| InChIKey | RBUXNNLHIXUKOM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|