C10H23N4O5PS — CID 139651681
[(carbamothioylamino)-(2,2,6,6-tetramethylpiperidin-1-yl)oxyamino] dihydrogen phosphate (PubChem CID 139651681) has the molecular formula C10H23N4O5PS and a molecular weight of 342.36 g/mol. Its IUPAC name is [(carbamothioylamino)-(2,2,6,6-tetramethylpiperidin-1-yl)oxyamino] dihydrogen phosphate.
| Compound Name | [(carbamothioylamino)-(2,2,6,6-tetramethylpiperidin-1-yl)oxyamino] dihydrogen phosphate |
|---|---|
| PubChem CID | 139651681 |
| Molecular Formula | C10H23N4O5PS |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | [(carbamothioylamino)-(2,2,6,6-tetramethylpiperidin-1-yl)oxyamino] dihydrogen phosphate |
| SMILES | CC1(C)CCCC(C)(C)N1ON(NC(N)=S)OP(=O)(O)O |
| InChI | InChI=1S/C10H23N4O5PS/c1-9(2)6-5-7-10(3,4)13(9)18-14(12-8(11)21)19-20(15,16)17/h5-7H2,1-4H3,(H3,11,12,21)(H2,15,16,17) |
| InChIKey | GKEOTFKKOLEPLS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|