C21H22BClF5N — CID 132507174
chloro-(2,3,4,5,6-pentafluorophenyl)-[2-(2,2,6,6-tetramethylpiperidin-1-yl)phenyl]borane (PubChem CID 132507174) has the molecular formula C21H22BClF5N and a molecular weight of 429.67 g/mol. Its IUPAC name is chloro-(2,3,4,5,6-pentafluorophenyl)-[2-(2,2,6,6-tetramethylpiperidin-1-yl)phenyl]borane.
| Compound Name | chloro-(2,3,4,5,6-pentafluorophenyl)-[2-(2,2,6,6-tetramethylpiperidin-1-yl)phenyl]borane |
|---|---|
| PubChem CID | 132507174 |
| Molecular Formula | C21H22BClF5N |
| Molecular Weight | 429.67 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | chloro-(2,3,4,5,6-pentafluorophenyl)-[2-(2,2,6,6-tetramethylpiperidin-1-yl)phenyl]borane |
| SMILES | CC1(C)CCCC(C)(C)N1c1ccccc1B(Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H22BClF5N/c1-20(2)10-7-11-21(3,4)29(20)13-9-6-5-8-12(13)22(23)14-15(24)17(26)19(28)18(27)16(14)25/h5-6,8-9H,7,10-11H2,1-4H3 |
| InChIKey | VUFLMWTYOGKQLH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|