C31H22BF10N — CID 164667596
bis(2,3,4,5,6-pentafluorophenyl)-[2-[[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]methyl]phenyl]borane (PubChem CID 164667596) has the molecular formula C31H22BF10N and a molecular weight of 609.32 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-[2-[[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]methyl]phenyl]borane.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-[2-[[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]methyl]phenyl]borane |
|---|---|
| PubChem CID | 164667596 |
| Molecular Formula | C31H22BF10N |
| Molecular Weight | 609.32 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-[2-[[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]methyl]phenyl]borane |
| SMILES | C[C@H]1CC(C)(C)N(Cc2ccccc2B(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c2ccccc21 |
| InChI | InChI=1S/C31H22BF10N/c1-14-12-31(2,3)43(18-11-7-5-9-16(14)18)13-15-8-4-6-10-17(15)32(19-21(33)25(37)29(41)26(38)22(19)34)20-23(35)27(39)30(42)28(40)24(20)36/h4-11,14H,12-13H2,1-3H3/t14-/m0/s1 |
| InChIKey | URNHGOTYGVGSNT-AWEZNQCLSA-N |
| XLogP | 6.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.32 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|