C21H26ClNO — CID 21407659
1-[2-[(4-chlorophenyl)methoxy]ethyl]-2,2,4-trimethyl-3,4-dihydroquinoline (PubChem CID 21407659) has the molecular formula C21H26ClNO and a molecular weight of 343.90 g/mol. Its IUPAC name is 1-[2-[(4-chlorophenyl)methoxy]ethyl]-2,2,4-trimethyl-3,4-dihydroquinoline.
| Compound Name | 1-[2-[(4-chlorophenyl)methoxy]ethyl]-2,2,4-trimethyl-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 21407659 |
| Molecular Formula | C21H26ClNO |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-[2-[(4-chlorophenyl)methoxy]ethyl]-2,2,4-trimethyl-3,4-dihydroquinoline |
| SMILES | CC1CC(C)(C)N(CCOCc2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C21H26ClNO/c1-16-14-21(2,3)23(20-7-5-4-6-19(16)20)12-13-24-15-17-8-10-18(22)11-9-17/h4-11,16H,12-15H2,1-3H3 |
| InChIKey | SASWYXUKLFVAPF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|