C16H22ClNO — CID 132649789
4-chloro-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)butan-1-one (PubChem CID 132649789) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is 4-chloro-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)butan-1-one.
| Compound Name | 4-chloro-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 132649789 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 4-chloro-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)butan-1-one |
| SMILES | CC1CC(C)(C)N(C(=O)CCCCl)c2ccccc21 |
| InChI | InChI=1S/C16H22ClNO/c1-12-11-16(2,3)18(15(19)9-6-10-17)14-8-5-4-7-13(12)14/h4-5,7-8,12H,6,9-11H2,1-3H3 |
| InChIKey | HIHLRQUSEOSZEH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|