C22H32N2O — CID 3226660
2-[2-(cyclohexen-1-yl)ethylamino]-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone (PubChem CID 3226660) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethylamino]-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethylamino]-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 3226660 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethylamino]-1-(2,2,4-trimethyl-3,4-dihydroquinolin-1-yl)ethanone |
| SMILES | CC1CC(C)(C)N(C(=O)CNCCC2=CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C22H32N2O/c1-17-15-22(2,3)24(20-12-8-7-11-19(17)20)21(25)16-23-14-13-18-9-5-4-6-10-18/h7-9,11-12,17,23H,4-6,10,13-16H2,1-3H3 |
| InChIKey | AMFNNUAJNVOMEE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|