C22H33N2O+ — CID 7406325
2-(cyclohexen-1-yl)ethyl-[2-oxo-2-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]ethyl]azanium (PubChem CID 7406325) has the molecular formula C22H33N2O+ and a molecular weight of 341.52 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)ethyl-[2-oxo-2-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]ethyl]azanium.
| Compound Name | 2-(cyclohexen-1-yl)ethyl-[2-oxo-2-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7406325 |
| Molecular Formula | C22H33N2O+ |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 2-(cyclohexen-1-yl)ethyl-[2-oxo-2-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]ethyl]azanium |
| SMILES | C[C@H]1CC(C)(C)N(C(=O)C[NH2+]CCC2=CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C22H32N2O/c1-17-15-22(2,3)24(20-12-8-7-11-19(17)20)21(25)16-23-14-13-18-9-5-4-6-10-18/h7-9,11-12,17,23H,4-6,10,13-16H2,1-3H3/p+1/t17-/m0/s1 |
| InChIKey | AMFNNUAJNVOMEE-KRWDZBQOSA-O |
| XLogP | 3.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|