C25H32N4OS — CID 41286909
N-[2-oxo-2-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]ethyl]-4-phenylpiperazine-1-carbothioamide (PubChem CID 41286909) has the molecular formula C25H32N4OS and a molecular weight of 436.63 g/mol. Its IUPAC name is N-[2-oxo-2-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]ethyl]-4-phenylpiperazine-1-carbothioamide.
| Compound Name | N-[2-oxo-2-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]ethyl]-4-phenylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 41286909 |
| Molecular Formula | C25H32N4OS |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N-[2-oxo-2-[(4S)-2,2,4-trimethyl-3,4-dihydroquinolin-1-yl]ethyl]-4-phenylpiperazine-1-carbothioamide |
| SMILES | C[C@H]1CC(C)(C)N(C(=O)CNC(=S)N2CCN(c3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H32N4OS/c1-19-17-25(2,3)29(22-12-8-7-11-21(19)22)23(30)18-26-24(31)28-15-13-27(14-16-28)20-9-5-4-6-10-20/h4-12,19H,13-18H2,1-3H3,(H,26,31)/t19-/m0/s1 |
| InChIKey | RULNRCBBCNDLIQ-IBGZPJMESA-N |
| XLogP | 4.00 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|