C12H17FN2 — CID 63219611
2-(2,2-dimethylpyrrolidin-1-yl)-6-fluoroaniline (PubChem CID 63219611) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 2-(2,2-dimethylpyrrolidin-1-yl)-6-fluoroaniline.
| Compound Name | 2-(2,2-dimethylpyrrolidin-1-yl)-6-fluoroaniline |
|---|---|
| PubChem CID | 63219611 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 2-(2,2-dimethylpyrrolidin-1-yl)-6-fluoroaniline |
| SMILES | CC1(C)CCCN1c1cccc(F)c1N |
| InChI | InChI=1S/C12H17FN2/c1-12(2)7-4-8-15(12)10-6-3-5-9(13)11(10)14/h3,5-6H,4,7-8,14H2,1-2H3 |
| InChIKey | OZWTUDDHNVZQFO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|