C38H56B2N6O2 — CID 139052675
(2R,8S)-4,10-dimethyl-2,8-diphenyl-2,8-bis[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]-4,10-diaza-1,7-diazonia-2,8-diboranuidatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,11-tetraene (PubChem CID 139052675) has the molecular formula C38H56B2N6O2 and a molecular weight of 650.53 g/mol. Its IUPAC name is (2R,8S)-4,10-dimethyl-2,8-diphenyl-2,8-bis[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]-4,10-diaza-1,7-diazonia-2,8-diboranuidatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,11-tetraene.
| Compound Name | (2R,8S)-4,10-dimethyl-2,8-diphenyl-2,8-bis[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]-4,10-diaza-1,7-diazonia-2,8-diboranuidatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,11-tetraene |
|---|---|
| PubChem CID | 139052675 |
| Molecular Formula | C38H56B2N6O2 |
| Molecular Weight | 650.53 g/mol |
| Exact Mass | 650.47 |
| IUPAC Name | (2R,8S)-4,10-dimethyl-2,8-diphenyl-2,8-bis[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]-4,10-diaza-1,7-diazonia-2,8-diboranuidatricyclo[7.3.0.03,7]dodeca-1(9),3(7),5,11-tetraene |
| SMILES | Cn1cc[n+]2c1[B@-](ON1C(C)(C)CCCC1(C)C)(c1ccccc1)[n+]1ccn(C)c1[B@@-]2(ON1C(C)(C)CCCC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C38H56B2N6O2/c1-35(2)23-17-24-36(3,4)45(35)47-39(31-19-13-11-14-20-31)33-41(9)28-30-44(33)40(32-21-15-12-16-22-32,34-42(10)27-29-43(34)39)48-46-37(5,6)25-18-26-38(46,7)8/h11-16,19-22,27-30H,17-18,23-26H2,1-10H3/t39-,40+ |
| InChIKey | ZFCRKJATTDUIHH-LQDDJWCHSA-N |
| XLogP | 3.41 |
| TPSA | 42.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|