C12H13FO — CID 84719917
8-fluoro-8-methyl-6,7-dihydro-5H-naphthalene-1-carbaldehyde (PubChem CID 84719917) has the molecular formula C12H13FO and a molecular weight of 192.23 g/mol. Its IUPAC name is 8-fluoro-8-methyl-6,7-dihydro-5H-naphthalene-1-carbaldehyde.
| Compound Name | 8-fluoro-8-methyl-6,7-dihydro-5H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 84719917 |
| Molecular Formula | C12H13FO |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 8-fluoro-8-methyl-6,7-dihydro-5H-naphthalene-1-carbaldehyde |
| SMILES | CC1(F)CCCc2cccc(C=O)c21 |
| InChI | InChI=1S/C12H13FO/c1-12(13)7-3-6-9-4-2-5-10(8-14)11(9)12/h2,4-5,8H,3,6-7H2,1H3 |
| InChIKey | PGJFEDAVRUFTMA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|