C22H25BN3+ — CID 166589203
5,8,20,20-tetramethyl-5,13-diaza-2-azonia-1-borapentacyclo[11.9.0.02,6.07,12.014,19]docosa-2(6),3,7,9,11,14,16,18-octaene (PubChem CID 166589203) has the molecular formula C22H25BN3+ and a molecular weight of 342.28 g/mol. Its IUPAC name is 5,8,20,20-tetramethyl-5,13-diaza-2-azonia-1-borapentacyclo[11.9.0.02,6.07,12.014,19]docosa-2(6),3,7,9,11,14,16,18-octaene.
| Compound Name | 5,8,20,20-tetramethyl-5,13-diaza-2-azonia-1-borapentacyclo[11.9.0.02,6.07,12.014,19]docosa-2(6),3,7,9,11,14,16,18-octaene |
|---|---|
| PubChem CID | 166589203 |
| Molecular Formula | C22H25BN3+ |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 5,8,20,20-tetramethyl-5,13-diaza-2-azonia-1-borapentacyclo[11.9.0.02,6.07,12.014,19]docosa-2(6),3,7,9,11,14,16,18-octaene |
| SMILES | Cc1cccc2c1-c1n(C)cc[n+]1B1CCC(C)(C)c3ccccc3N12 |
| InChI | InChI=1S/C22H25BN3/c1-16-8-7-11-19-20(16)21-24(4)14-15-25(21)23-13-12-22(2,3)17-9-5-6-10-18(17)26(19)23/h5-11,14-15H,12-13H2,1-4H3/q+1 |
| InChIKey | VOUHSFHQYKVCJR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|