C16H27N2Y3+ — CID 158292360
1,3-dimethyl-2-(2-methylphenyl)imidazol-1-ium;ethane;tris(yttrium) (PubChem CID 158292360) has the molecular formula C16H27N2Y3+ and a molecular weight of 514.12 g/mol. Its IUPAC name is 1,3-dimethyl-2-(2-methylphenyl)imidazol-1-ium;ethane;tris(yttrium).
| Compound Name | 1,3-dimethyl-2-(2-methylphenyl)imidazol-1-ium;ethane;tris(yttrium) |
|---|---|
| PubChem CID | 158292360 |
| Molecular Formula | C16H27N2Y3+ |
| Molecular Weight | 514.12 g/mol |
| Exact Mass | 513.93 |
| IUPAC Name | 1,3-dimethyl-2-(2-methylphenyl)imidazol-1-ium;ethane;tris(yttrium) |
| SMILES | CC.CC.Cc1ccccc1-c1n(C)cc[n+]1C.[Y].[Y].[Y] |
| InChI | InChI=1S/C12H15N2.2C2H6.3Y/c1-10-6-4-5-7-11(10)12-13(2)8-9-14(12)3;2*1-2;;;/h4-9H,1-3H3;2*1-2H3;;;/q+1;;;;; |
| InChIKey | DWFTUGIHMAEOHV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.12 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|