C15H16N3+ — CID 140917884
6-(1,3-dimethylimidazol-1-ium-2-yl)-5-methylquinoline (PubChem CID 140917884) has the molecular formula C15H16N3+ and a molecular weight of 238.31 g/mol. Its IUPAC name is 6-(1,3-dimethylimidazol-1-ium-2-yl)-5-methylquinoline.
| Compound Name | 6-(1,3-dimethylimidazol-1-ium-2-yl)-5-methylquinoline |
|---|---|
| PubChem CID | 140917884 |
| Molecular Formula | C15H16N3+ |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 6-(1,3-dimethylimidazol-1-ium-2-yl)-5-methylquinoline |
| SMILES | Cc1c(-c2n(C)cc[n+]2C)ccc2ncccc12 |
| InChI | InChI=1S/C15H16N3/c1-11-12-5-4-8-16-14(12)7-6-13(11)15-17(2)9-10-18(15)3/h4-10H,1-3H3/q+1 |
| InChIKey | POAKYNJKLPPXKS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|