C5H8IN2+ — CID 12009773
2-iodo-1,3-dimethylimidazol-1-ium (PubChem CID 12009773) has the molecular formula C5H8IN2+ and a molecular weight of 223.04 g/mol. Its IUPAC name is 2-iodo-1,3-dimethylimidazol-1-ium.
| Compound Name | 2-iodo-1,3-dimethylimidazol-1-ium |
|---|---|
| PubChem CID | 12009773 |
| Molecular Formula | C5H8IN2+ |
| Molecular Weight | 223.04 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 2-iodo-1,3-dimethylimidazol-1-ium |
| SMILES | Cn1cc[n+](C)c1I |
| InChI | InChI=1S/C5H8IN2/c1-7-3-4-8(2)5(7)6/h3-4H,1-2H3/q+1 |
| InChIKey | MGRIYEROULYODG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.04 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|