About 2-iodo-1,3-dimethylimidazol-1-ium
2-iodo-1,3-dimethylimidazol-1-ium (PubChem CID 12009773) has the molecular formula C5H8IN2+
and a molecular weight of 223.04 g/mol. Its IUPAC name is 2-iodo-1,3-dimethylimidazol-1-ium.
Molecular Properties
| Compound Name | 2-iodo-1,3-dimethylimidazol-1-ium |
| PubChem CID | 12009773 |
| Molecular Formula | C5H8IN2+ |
| Molecular Weight | 223.04 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 2-iodo-1,3-dimethylimidazol-1-ium |
| SMILES | Cn1cc[n+](C)c1I |
| InChI | InChI=1S/C5H8IN2/c1-7-3-4-8(2)5(7)6/h3-4H,1-2H3/q+1 |
| InChIKey | MGRIYEROULYODG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.04 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-1,3-dimethylimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-1,3-dimethylimidazol-1-ium?
The IUPAC name of 2-iodo-1,3-dimethylimidazol-1-ium (CID 12009773) is 2-iodo-1,3-dimethylimidazol-1-ium.
What is the SMILES notation for 2-iodo-1,3-dimethylimidazol-1-ium?
The canonical SMILES for 2-iodo-1,3-dimethylimidazol-1-ium is Cn1cc[n+](C)c1I.
What is the InChIKey of 2-iodo-1,3-dimethylimidazol-1-ium?
The InChIKey is MGRIYEROULYODG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8IN2/c1-7-3-4-8(2)5(7)6/h3-4H,1-2H3/q+1.
What are the key properties of 2-iodo-1,3-dimethylimidazol-1-ium?
2-iodo-1,3-dimethylimidazol-1-ium has a molecular weight of 223.04 g/mol, XLogP of 0.45, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-1,3-dimethylimidazol-1-ium is sourced from PubChem (CID 12009773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).