C6H8N2SSe — CID 101083679
(1,3-dimethylimidazol-1-ium-2-yl)-sulfanylidenemethaneselenolate (PubChem CID 101083679) has the molecular formula C6H8N2SSe and a molecular weight of 219.17 g/mol. Its IUPAC name is (1,3-dimethylimidazol-1-ium-2-yl)-sulfanylidenemethaneselenolate.
| Compound Name | (1,3-dimethylimidazol-1-ium-2-yl)-sulfanylidenemethaneselenolate |
|---|---|
| PubChem CID | 101083679 |
| Molecular Formula | C6H8N2SSe |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | (1,3-dimethylimidazol-1-ium-2-yl)-sulfanylidenemethaneselenolate |
| SMILES | Cn1cc[n+](C)c1C(=S)[Se-] |
| InChI | InChI=1S/C6H8N2SSe/c1-7-3-4-8(2)5(7)6(9)10/h3-4H,1-2H3 |
| InChIKey | SYFAEEGHXTXMPG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|