About (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone
(2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone (PubChem CID 171393469) has the molecular formula C12H12BrN2O+
and a molecular weight of 280.14 g/mol. Its IUPAC name is (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone.
Molecular Properties
| Compound Name | (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone |
| PubChem CID | 171393469 |
| Molecular Formula | C12H12BrN2O+ |
| Molecular Weight | 280.14 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone |
| SMILES | Cn1cc[n+](C)c1C(=O)c1ccccc1Br |
| InChI | InChI=1S/C12H12BrN2O/c1-14-7-8-15(2)12(14)11(16)9-5-3-4-6-10(9)13/h3-8H,1-2H3/q+1 |
| InChIKey | VBOPZLRLCAGURX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone?
The IUPAC name of (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone (CID 171393469) is (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone.
What is the SMILES notation for (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone?
The canonical SMILES for (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone is Cn1cc[n+](C)c1C(=O)c1ccccc1Br.
What is the InChIKey of (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone?
The InChIKey is VBOPZLRLCAGURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrN2O/c1-14-7-8-15(2)12(14)11(16)9-5-3-4-6-10(9)13/h3-8H,1-2H3/q+1.
What are the key properties of (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone?
(2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone has a molecular weight of 280.14 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)methanone is sourced from PubChem (CID 171393469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).