C5H9ClF7N2P — CID 175136521
2-fluoro-1,3-dimethylimidazol-1-ium;hexafluorophosphate;hydrochloride (PubChem CID 175136521) has the molecular formula C5H9ClF7N2P and a molecular weight of 296.55 g/mol. Its IUPAC name is 2-fluoro-1,3-dimethylimidazol-1-ium;hexafluorophosphate;hydrochloride.
| Compound Name | 2-fluoro-1,3-dimethylimidazol-1-ium;hexafluorophosphate;hydrochloride |
|---|---|
| PubChem CID | 175136521 |
| Molecular Formula | C5H9ClF7N2P |
| Molecular Weight | 296.55 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 2-fluoro-1,3-dimethylimidazol-1-ium;hexafluorophosphate;hydrochloride |
| SMILES | Cl.Cn1cc[n+](C)c1F.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C5H8FN2.ClH.F6P/c1-7-3-4-8(2)5(7)6;;1-7(2,3,4,5)6/h3-4H,1-2H3;1H;/q+1;;-1 |
| InChIKey | LDJOQXCKFPBOKG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|