C7H13N4+ — CID 123294209
(1,3-dimethylimidazol-1-ium-2-yl)-ethyldiazene (PubChem CID 123294209) has the molecular formula C7H13N4+ and a molecular weight of 153.21 g/mol. Its IUPAC name is (1,3-dimethylimidazol-1-ium-2-yl)-ethyldiazene.
| Compound Name | (1,3-dimethylimidazol-1-ium-2-yl)-ethyldiazene |
|---|---|
| PubChem CID | 123294209 |
| Molecular Formula | C7H13N4+ |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.11 |
| IUPAC Name | (1,3-dimethylimidazol-1-ium-2-yl)-ethyldiazene |
| SMILES | CC/N=N/c1n(C)cc[n+]1C |
| InChI | InChI=1S/C7H13N4/c1-4-8-9-7-10(2)5-6-11(7)3/h5-6H,4H2,1-3H3/q+1 |
| InChIKey | CBUGRQQAMCBRQV-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|