C15H20N5O+ — CID 157440046
1-[4-amino-3-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]butan-2-one (PubChem CID 157440046) has the molecular formula C15H20N5O+ and a molecular weight of 286.36 g/mol. Its IUPAC name is 1-[4-amino-3-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]butan-2-one.
| Compound Name | 1-[4-amino-3-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]butan-2-one |
|---|---|
| PubChem CID | 157440046 |
| Molecular Formula | C15H20N5O+ |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[4-amino-3-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]butan-2-one |
| SMILES | CCC(=O)Cc1ccc(N)c(/N=N/c2n(C)cc[n+]2C)c1 |
| InChI | InChI=1S/C15H19N5O/c1-4-12(21)9-11-5-6-13(16)14(10-11)17-18-15-19(2)7-8-20(15)3/h5-8,10,16H,4,9H2,1-3H3/p+1 |
| InChIKey | CHGRLLQCADZKID-UHFFFAOYSA-O |
| XLogP | 2.37 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|